
CAS 106981-51-5
:5-Amino-2-(1H-pyrrol-1-yl)benzonitrile
Description:
5-Amino-2-(1H-pyrrol-1-yl)benzonitrile, with the CAS number 106981-51-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group and a pyrrole moiety. This compound features a nitrile functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The pyrrole ring adds to its heterocyclic nature, which can influence its electronic properties and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could lead to the development of new therapeutic agents. Overall, 5-Amino-2-(1H-pyrrol-1-yl)benzonitrile is a versatile compound with significant implications in both synthetic chemistry and medicinal chemistry.
Formula:C11H9N3
InChI:InChI=1S/C11H9N3/c12-8-9-7-10(13)3-4-11(9)14-5-1-2-6-14/h1-7H,13H2
InChI key:InChIKey=VDMUMLCWGQEGDZ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC(N)=C1)N2C=CC=C2
Synonyms:- Benzonitrile, 5-amino-2-(1H-pyrrol-1-yl)-
- 5-Amino-2-(1H-pyrrol-1-yl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.