CAS 106981-60-6
:2-(2-Ethoxy-4-nitrophenyl)-1H-isoindole-1,3(2H)-dione
Description:
2-(2-Ethoxy-4-nitrophenyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 106981-60-6, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core and a nitrophenyl substituent. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its electronic properties and reactivity. It is likely to be soluble in organic solvents, reflecting its aromatic nature, while its solubility in water may be limited due to the presence of the ethoxy group. The nitro group can participate in electrophilic substitution reactions, making this compound potentially useful in various chemical syntheses. Additionally, the isoindole moiety may exhibit biological activity, suggesting potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, this compound represents a unique combination of functional groups that may lend itself to diverse applications in research and industry.
Formula:C16H12N2O5
InChI:InChI=1S/C16H12N2O5/c1-2-23-14-9-10(18(21)22)7-8-13(14)17-15(19)11-5-3-4-6-12(11)16(17)20/h3-9H,2H2,1H3
InChI key:InChIKey=DHMIRCIBPRTIDM-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C=2C1=CC=CC2)C3=C(OCC)C=C(N(=O)=O)C=C3
Synonyms:- 2-(2-Ethoxy-4-nitrophenyl)-1H-isoindole-1,3(2H)-dione
- 3-Ethyloxy-4-(phthalimidyl)-1-nitrobenzene
- 2-(2-Ethoxy-4-nitrophenyl)isoindoline-1,3-dione
- 1H-Isoindole-1,3(2H)-dione, 2-(2-ethoxy-4-nitrophenyl)-
- 2-(2-Ethoxy-4-nitrophenyl)isoindole-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(2-Ethoxy-4-nitrophenyl)-1H-isoindole-1,3(2H)-dione
CAS:Formula:C16H12N2O5Color and Shape:SolidMolecular weight:312.27692-(4-Nitro-2-ethoxyphenyl)pthalimide
CAS:Controlled ProductApplications 2-(4-Nitro-2-ethoxyphenyl)pthalimide (cas# 106981-60-6) is a compound useful in organic synthesis.
Formula:C16H12N2O5Color and Shape:NeatMolecular weight:312.28

