CymitQuimica logo

CAS 106983-29-3

:

3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)butanamide

Description:
3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)butanamide, with the CAS number 106983-29-3, is a chemical compound characterized by its unique structural features, which include a butanamide backbone and a tetrahydrofuran ring. This compound typically exhibits properties associated with both amides and cyclic ketones, such as moderate polarity and potential hydrogen bonding capabilities due to the presence of the amide functional group. The tetrahydrofuran moiety contributes to its cyclic structure, which can influence its reactivity and solubility in various solvents. Additionally, the presence of the keto group (3-oxo) suggests that it may participate in various chemical reactions, including condensation and nucleophilic addition. The compound's specific applications and biological activities would depend on its interactions with other molecules, making it of interest in fields such as medicinal chemistry and organic synthesis. Overall, its unique structure and functional groups position it as a potentially versatile compound in chemical research and development.
Formula:C8H11NO4
InChI:InChI=1S/C8H11NO4/c1-5(10)4-7(11)9-6-2-3-13-8(6)12/h6H,2-4H2,1H3,(H,9,11)
InChI key:InChIKey=FIHPLICEAUNEFV-UHFFFAOYSA-N
SMILES:N(C(CC(C)=O)=O)C1C(=O)OCC1
Synonyms:
  • 3-Oxo-N-(2-oxooxolan-3-yl)butanamide
  • 3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)butanamide
  • Butanamide, 3-oxo-N-(tetrahydro-2-oxo-3-furanyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.