CymitQuimica logo

CAS 106996-32-1

:

N-[5-(Trimethoxysilyl)-2-Aza-1-Oxopentyl]Caprolactam

Description:
N-[5-(Trimethoxysilyl)-2-Aza-1-Oxopentyl]Caprolactam, with the CAS number 106996-32-1, is a chemical compound that features a caprolactam moiety, which is a cyclic amide commonly used in the production of nylon. This compound is characterized by the presence of a trimethoxysilyl group, which enhances its reactivity and compatibility with silicate materials, making it useful in applications such as surface modification and adhesion promotion. The azetidine ring contributes to its structural complexity, providing potential for various chemical interactions. The trimethoxysilyl group allows for covalent bonding to silicate surfaces, which is advantageous in the formulation of composites and coatings. Additionally, the compound may exhibit properties such as improved thermal stability and mechanical strength when incorporated into polymer matrices. Its unique structure suggests potential applications in fields like materials science, coatings, and polymer chemistry, particularly in enhancing the performance of silicate-based materials. However, specific safety and handling guidelines should be followed due to the presence of reactive silane groups.
Formula:C13H26N2O5Si
InChI:InChI=1/C13H26N2O5Si/c1-18-21(19-2,20-3)11-7-9-14-13(17)15-10-6-4-5-8-12(15)16/h4-11H2,1-3H3,(H,14,17)
SMILES:CO[Si](CCCN=C(N1CCCCCC1=O)O)(OC)OC
Synonyms:
  • 1H-Azepine-1-carboxamide, hexahydro-2-oxo-N-[3-(trimethoxysilyl)propyl]-
  • 2-Oxo-N-[3-(trimethoxysilyl)propyl]azepane-1-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.