CAS 107-52-8: Tetradecamethylhexasiloxane
Description:Tetradecamethylhexasiloxane, with the CAS number 107-52-8, is a siloxane compound characterized by its linear structure composed of alternating silicon and oxygen atoms, with methyl groups attached to the silicon atoms. This compound typically exhibits low viscosity and is known for its thermal stability, making it suitable for various applications, including as a lubricant and in cosmetic formulations. Its chemical structure contributes to its hydrophobic properties, allowing it to repel water and resist moisture. Tetradecamethylhexasiloxane is also noted for its low surface tension, which enhances its spreading and wetting characteristics. Additionally, it is generally considered to be non-toxic and biocompatible, which is advantageous for use in personal care products. However, as with any chemical substance, it is essential to handle it according to safety guidelines to mitigate any potential environmental or health impacts. Overall, its unique properties make it valuable in both industrial and consumer applications.
Formula:C14H42O5Si6
InChI:InChI=1S/C14H42O5Si6/c1-20(2,3)15-22(7,8)17-24(11,12)19-25(13,14)18-23(9,10)16-21(4,5)6/h1-14H3
InChI key:InChIKey=ADANNTOYRVPQLJ-UHFFFAOYSA-N
SMILES:O([Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C
- Synonyms:
- 1,1,1,3,3,5,5,7,7,9,9,11,11,11-Tetradecamethylhexasiloxane
- Hexasiloxane, 1,1,1,3,3,5,5,7,7,9,9,11,11,11-tetradecamethyl-
- Hexasiloxane, tetradecamethyl-
- [Dimethyl(trimethylsilyloxy)silyl]oxy-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilane
- Tetradecamethylhexasiloxane