CAS 107-71-1
:tert-Butyl peroxyacetate
Description:
Tert-Butyl peroxyacetate, with the CAS number 107-71-1, is an organic peroxide commonly used as a radical initiator in polymerization processes. It is characterized by its colorless to pale yellow liquid form and has a distinctive odor. This compound is known for its relatively low stability, particularly when exposed to heat, shock, or friction, which can lead to decomposition and the release of oxygen. Tert-Butyl peroxyacetate has a moderate solubility in organic solvents but is generally insoluble in water. Its chemical structure features a peroxy linkage, which contributes to its reactivity, making it effective in initiating free radical reactions. Safety precautions are essential when handling this substance, as it can be hazardous due to its potential to cause skin and eye irritation, as well as its explosive nature under certain conditions. Proper storage in a cool, dry place away from incompatible materials is crucial to minimize risks associated with its use.
Formula:C6H12O3
InChI:InChI=1S/C6H12O3/c1-5(7)8-9-6(2,3)4/h1-4H3
InChI key:InChIKey=SWAXTRYEYUTSAP-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)OC(C)=O
Synonyms:- Ethaneperoxoic acid, 1,1-dimethylethyl ester
- tert-Butyl peroxyacetate
- Peroxyacetic acid, tert-butyl ester
- tert-Butyl peracetate
- Lupersol 70
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.