CAS 1070-02-6
:Boronic acid, (2-bromoethyl)-, dibutyl ester
Description:
Boronic acid, (2-bromoethyl)-, dibutyl ester, with the CAS number 1070-02-6, is an organoboron compound characterized by the presence of a boronic acid functional group and a dibutyl ester moiety. This compound typically exhibits a polar nature due to the boron atom's ability to form coordinate covalent bonds, which can influence its reactivity and solubility in various solvents. The presence of the bromoethyl group introduces a halogen, which can participate in nucleophilic substitution reactions, making the compound useful in organic synthesis. Additionally, the dibutyl ester groups contribute to its hydrophobic characteristics, affecting its interaction with biological systems and its potential applications in drug delivery or as a reagent in chemical reactions. Boronic acids are known for their ability to form reversible complexes with diols, which is significant in the development of sensors and in medicinal chemistry. Overall, this compound's unique structure allows for diverse applications in synthetic organic chemistry and materials science.
Formula:C10H22BBrO2
InChI:InChI=1S/C10H22BBrO2/c1-3-5-9-13-11(7-8-12)14-10-6-4-2/h3-10H2,1-2H3
InChI key:InChIKey=LUOMZQAOFVBYOO-UHFFFAOYSA-N
SMILES:B(OCCCC)(OCCCC)CCBr
Synonyms:- Ethaneboronic acid, 2-bromo-, dibutyl ester
- Boronic acid, (2-bromoethyl)-, dibutyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
