CAS 1070-95-7
:Guanoctine hydrochloride
Description:
Guanoctine hydrochloride, with the CAS number 1070-95-7, is a chemical compound that is primarily recognized as a muscle relaxant and is used in various medical applications. It is a quaternary ammonium compound, which means it contains a positively charged nitrogen atom bonded to four organic groups. This structure contributes to its pharmacological properties, particularly its ability to block neuromuscular transmission, making it useful in anesthesia and certain surgical procedures. Guanoctine hydrochloride is typically administered in a clinical setting and is known for its rapid onset of action. In terms of physical characteristics, it is usually encountered as a white to off-white crystalline powder that is soluble in water. Safety and handling precautions are essential, as with many pharmacological agents, due to potential side effects and interactions with other medications. Overall, guanoctine hydrochloride plays a significant role in medical practice, particularly in the context of muscle relaxation during surgical interventions.
Formula:C9H21N3·ClH
InChI:InChI=1S/C9H21N3.ClH/c1-8(2,3)6-9(4,5)12-7(10)11;/h6H2,1-5H3,(H4,10,11,12);1H
InChI key:InChIKey=QRFSLMLESAIOMB-UHFFFAOYSA-N
SMILES:C(C(NC(=N)N)(C)C)C(C)(C)C.Cl
Synonyms:- Guanoctine hydrochloride
- BP 1184
- Guanidine, (1,1,3,3-tetramethylbutyl)-, monohydrochloride
- A 7283
- Guanidine, N-(1,1,3,3-tetramethylbutyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Guanoctine hydrochloride
CAS:Guanoctine hydrochloride has antihypertensive activity.Formula:C9H22ClN3Color and Shape:SolidMolecular weight:207.74
