CAS 107008-29-7

3-Hydroxy-N-[2-phenyl-2-(2-thienyl)ethenyl]-5-(trifluoromethyl)benzo[b]thiophene-2-carboxamide

Description:

3-Hydroxy-N-[2-phenyl-2-(2-thienyl)ethenyl]-5-(trifluoromethyl)benzo[b]thiophene-2-carboxamide, with the CAS number 107008-29-7, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as a hydroxyl group, a carboxamide, and a trifluoromethyl group. This compound features a benzo[b]thiophene core, which contributes to its aromatic properties and potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. Additionally, the phenyl and thienyl substituents provide further structural diversity, potentially impacting its reactivity and interactions with biological targets. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity would depend on the specific conditions, including pH and solvent environment. Overall, this compound exemplifies the intricate design often found in drug development, where structural modifications can lead to significant changes in biological activity.

Formula: C₂₂H₁₄F₃NO₂S₂

InChI: InChI=1S/C22H14F3NO2S2/c23-22(24,25)14-8-9-18-15(11-14)19(27)20(30-18)21(28)26-12-16(17-7-4-10-29-17)13-5-2-1-3-6-13/h1-12,27H,(H,26,28)

InChI key: InChIKey=MWRHQMNEBAXDOF-UHFFFAOYSA-N

SMILES: OC=1C=2C(SC1C(NC=C(C3=CC=CS3)C4=CC=CC=C4)=O)=CC=C(C(F)(F)F)C2

Synonyms:

• L 652343
• 3-Hydroxy-N-[2-phenyl-2-(2-thienyl)ethenyl]-5-(trifluoromethyl)benzo[b]thiophene-2-carboxamide
• Benzo[b]thiophene-2-carboxamide, 3-hydroxy-N-[2-phenyl-2-(2-thienyl)ethenyl]-5-(trifluoromethyl)-