CAS 107021-38-5
:X-?-Gal 5-Bromo-4-chloro-3-indolyl-~-D-galactoside
Description:
The chemical substance known as X-?-Gal, with the CAS number 107021-38-5, is a synthetic substrate commonly used in molecular biology and biochemistry as a chromogenic indicator for the enzyme β-galactosidase. This compound is characterized by its structure, which includes a galactose moiety linked to a 5-bromo-4-chloro-3-indolyl group. When β-galactosidase cleaves the galactoside bond, it releases the indole derivative, leading to a color change that can be visually detected, typically resulting in a blue precipitate. This property makes X-?-Gal particularly useful in applications such as gene expression studies, where it serves as a reporter for the activity of lacZ gene products in various organisms. The compound is generally soluble in organic solvents and exhibits stability under standard laboratory conditions, although it should be handled with care due to its potential toxicity and the need for proper disposal methods.
Formula:C14H15BrClNO6
InChI:InChI=1/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11-,12+,13-,14+/m0/s1
Synonyms:- Magenta-Gal
- 5-Bromo-4-chloro-3-indolyl-alpha-D-galactopyranoside
- (2S,3S,4R,5R,6S)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
5-Bromo-4-chloro-3-indolyl-α-D-galactoside
CAS:<p>Substrate for beta-galactosidase</p>Formula:C14H15BrClNO6Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:408.635-Bromo-4-chloro-3-indolyl a-D-galactopyranoside
CAS:Formula:C14H15BrClNO6Purity:98%Color and Shape:SolidMolecular weight:408.62905-Bromo-4-chloro-3-indolyl-α-D-galactoside
CAS:<p>5-Bromo-4-chloro-3-indolyl-α-D-galactoside</p>Purity:>98%Color and Shape: white powderMolecular weight:408.63g/mol5-Bromo-4-chloro-3-indolyl a-D-galactopyranoside
CAS:Formula:C14H15BrClNO6Purity:≥ 98.0%Color and Shape:White powder to colourless crystalsMolecular weight:408.63X-α-Gal
CAS:X-alpha-Gal is a substrate for alpha-galactosidase. It is used for differentiating alpha-galactosidase-positive strains of yeast.Formula:C14H15BrClNO6Purity:99.7% - 99.98%Color and Shape:SolidMolecular weight:408.635-Bromo-4-chloro-3-indoxyl-alpha-D-galactopyranoside
CAS:<p>Chromogenic substrate for α-galactosidase yielding a blue precipitate. Used for species differentiation within the family Enterobacteriaceae and differentiation of Bifido bacteria species from Lactobacillus species.</p>Formula:C14H15BrClNO6Purity:Min. 99 Area-%Molecular weight:408.64 g/mol5-Bromo-4-Chloro-3-Indolyl-a-D-Galactopyranoside (X-a-Gal) for molecular biology, 98%
CAS:Formula:C14H15BrClNO6Purity:min. 99%Color and Shape:White, Crystalline powderMolecular weight:408.63







