CAS 107025-80-9
:2-(4-(4-fluorobenzoyl)piperidin-1-yl)-2'-acetonaphthone
Description:
2-(4-(4-fluorobenzoyl)piperidin-1-yl)-2'-acetonaphthone, with the CAS number 107025-80-9, is a chemical compound that belongs to the class of naphthone derivatives. This substance features a piperidine ring substituted with a 4-fluorobenzoyl group, which contributes to its potential biological activity. The presence of the acetonaphthone moiety suggests that it may exhibit properties related to both aromaticity and ketone functionality. The fluorine atom in the structure can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural characteristics that could interact with biological targets. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure and purity. As with many compounds of this nature, understanding its behavior in biological systems and its potential applications would require further research and investigation.
Formula:C24H23ClFNO2
InChI:InChI=1/C24H22FNO2.ClH/c25-22-9-7-18(8-10-22)24(28)19-11-13-26(14-12-19)16-23(27)21-6-5-17-3-1-2-4-20(17)15-21;/h1-10,15,19H,11-14,16H2;1H
SMILES:c1ccc2cc(ccc2c1)C(=O)CN1CCC(CC1)C(=O)c1ccc(cc1)F.Cl
Synonyms:- E 2001
- Ethanone, 2-(4-(4-fluorobenzoyl)-1-piperidinyl)-1-(2-naphthalenyl)-, hydrochlorde
- 2-[4-(4-Fluorobenzoyl)Piperidin-1-Yl]-1-(Naphthalen-2-Yl)Ethanone Hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.