CymitQuimica logo

CAS 107027-42-9

:

8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid

Description:
8-Methyl-2-pyridin-4-ylquinoline-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core fused with a pyridine ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl group at the 8-position and the pyridine moiety at the 2-position enhances its potential for various chemical interactions, making it a candidate for applications in medicinal chemistry and organic synthesis. The compound's molecular structure allows for potential hydrogen bonding and π-π stacking interactions, which can influence its solubility and reactivity. Additionally, its unique arrangement of heteroatoms may impart specific biological activities, making it of interest in drug discovery and development. The CAS number 107027-42-9 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, this compound exemplifies the diverse functionalities that can arise from heterocyclic chemistry.
Formula:C16H12N2O2
InChI:InChI=1/C16H12N2O2/c1-10-3-2-4-12-13(16(19)20)9-14(18-15(10)12)11-5-7-17-8-6-11/h2-9H,1H3,(H,19,20)
InChI key:KLSIJLUVNKNDFJ-UHFFFAOYSA-N
SMILES:Cc1cccc2c(cc(c3ccncc3)nc12)C(=O)O
Synonyms:
  • 4-Quinolinecarboxylic Acid, 8-Methyl-2-(4-Pyridinyl)-
Found 1 products.