CAS 107027-44-1

2-(4-Bromophenyl)-8-methyl-4-quinolinecarboxylic acid

Description:

2-(4-Bromophenyl)-8-methyl-4-quinolinecarboxylic acid, with the CAS number 107027-44-1, is a chemical compound that belongs to the class of quinoline derivatives. This compound features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a bromophenyl group at the 2-position and a methyl group at the 8-position contributes to its unique chemical properties and potential biological activities. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the fields of anti-inflammatory or antimicrobial agents. However, specific biological activity and toxicity profiles would require further investigation through experimental studies.

Formula: C₁₇H₁₂BrNO₂

InChI: InChI=1S/C17H12BrNO2/c1-10-3-2-4-13-14(17(20)21)9-15(19-16(10)13)11-5-7-12(18)8-6-11/h2-9H,1H3,(H,20,21)

InChI key: InChIKey=AXOVQGHAUJNNRK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(Br)C=C3)C(C)=CC=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 2-(4-bromophenyl)-8-methyl-
• 2-(4-Bromophenyl)-8-methyl-4-quinolinecarboxylic acid