CymitQuimica logo

CAS 1070295-74-7

:

tert-butyl (3S,5R)-5-(hydroxymethyl)pyrrolidin-3-ylcarbamate

Description:
Tert-butyl (3S,5R)-5-(hydroxymethyl)pyrrolidin-3-ylcarbamate is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a hydroxymethyl group and a tert-butyl group, contributing to its steric bulk and solubility properties. The carbamate functional group indicates that it can participate in various chemical reactions, including hydrolysis and transesterification. This compound's stereochemistry, denoted by the (3S,5R) configuration, suggests that it may exhibit specific biological activity or interact with biological targets in a particular manner, making it of interest in medicinal chemistry. Its molecular structure allows for potential applications in pharmaceuticals, particularly in the development of drugs that require specific stereochemical configurations for efficacy. Additionally, the presence of the hydroxymethyl group may enhance its solubility in polar solvents, which is advantageous for formulation in various chemical and biological contexts.
Formula:C10H20N2O3
InChI:InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-7-4-8(6-13)11-5-7/h7-8,11,13H,4-6H2,1-3H3,(H,12,14)/t7-,8+/m0/s1
InChI key:DWYPGXBZFDWCPC-JGVFFNPUSA-N
SMILES:CC(C)(C)OC(=O)N[C@H]1C[C@@H](NC1)CO
Synonyms:
  • tert-butyl N-[(3S,5R)-5-(hydroxyMethyl)pyrrolidin-3-yl]carbaMate
  • (2R,4S)-2-HydroxyMethyl-4-Boc-aMinopyrrolidine hydrochloride
Found 4 products.