CymitQuimica logo

CAS 1070377-34-2

:

4-[[6-Chloro-2-[(4-cyanophenyl)amino]-4-pyrimidinyl]oxy]-3,5-dimethylbenzonitrile

Description:
4-[[6-Chloro-2-[(4-cyanophenyl)amino]-4-pyrimidinyl]oxy]-3,5-dimethylbenzonitrile, with CAS number 1070377-34-2, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. This compound features a pyrimidine ring, a chloro substituent, and a benzonitrile moiety, indicating potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the cyanophenyl group suggests it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in drug formulation. Additionally, the compound's structural features may contribute to its biological activity, making it a candidate for further research in areas such as cancer therapy or other therapeutic applications. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C20H14ClN5O
InChI:InChI=1S/C20H14ClN5O/c1-12-7-15(11-23)8-13(2)19(12)27-18-9-17(21)25-20(26-18)24-16-5-3-14(10-22)4-6-16/h3-9H,1-2H3,(H,24,25,26)
InChI key:InChIKey=CMORVDDKOVDMDP-UHFFFAOYSA-N
SMILES:O(C1=NC(NC2=CC=C(C#N)C=C2)=NC(Cl)=C1)C3=C(C)C=C(C#N)C=C3C
Synonyms:
  • Benzonitrile, 4-[[6-chloro-2-[(4-cyanophenyl)amino]-4-pyrimidinyl]oxy]-3,5-dimethyl-
  • 4-[[6-Chloro-2-[(4-cyanophenyl)amino]-4-pyrimidinyl]oxy]-3,5-dimethylbenzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.