CAS 107048-59-9
:methyl (2Z)-2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoate
Description:
Methyl (2Z)-2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoate, with CAS number 107048-59-9, is an organic compound characterized by its complex structure, which includes a methoxy group, a bromomethyl group, and an enol ester functionality. This compound features a double bond in the prop-2-enoate moiety, indicating it is an unsaturated ester. The presence of the bromomethyl group suggests potential reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The methoxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the compound's stereochemistry, indicated by the (2Z) configuration, suggests specific spatial arrangements that can affect its chemical behavior and interactions. Overall, this compound's unique structural features make it a candidate for further investigation in chemical research and potential applications in pharmaceuticals or agrochemicals.
Formula:C12H13BrO3
InChI:InChI=1/C12H13BrO3/c1-15-8-11(12(14)16-2)10-6-4-3-5-9(10)7-13/h3-6,8H,7H2,1-2H3/b11-8-
SMILES:CO/C=C(/c1ccccc1CBr)\C(=O)OC
Synonyms:- Methyl 2-(2-bromomethylphenyl)-3-methoxyacrylate
- Benzeneacetic acid, 2-(bromomethyl)-α-(methoxymethylene)-, methyl ester
- Benzeneacetic acid, 2-(broMoMethyl)-a-(MethoxyMethylene)-, Methyl ester
- 2-(Bromomethyl)-alpha-(methoxymethylene)benzeneacetic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.