CymitQuimica logo

CAS 1070879-30-9

:

4-Bromo-6-chloroquinoline

Description:
4-Bromo-6-chloroquinoline is a heterocyclic organic compound that belongs to the quinoline family, characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features both bromine and chlorine substituents, which can significantly influence its chemical reactivity and biological activity. The presence of these halogens can enhance the compound's lipophilicity, potentially affecting its interaction with biological targets. 4-Bromo-6-chloroquinoline may exhibit antimicrobial, antimalarial, or anticancer properties, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to the development of derivatives with improved efficacy or selectivity. Additionally, the compound's stability and solubility in organic solvents are important characteristics that facilitate its use in laboratory and industrial applications. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are essential when handling and utilizing 4-Bromo-6-chloroquinoline in research or pharmaceutical contexts.
Formula:C9H5BrClN
InChI:InChI=1S/C9H5BrClN/c10-8-3-4-12-9-2-1-6(11)5-7(8)9/h1-5H
InChI key:FEBLUGZKVJAOLT-UHFFFAOYSA-N
SMILES:C1=CC2=NC=CC(=C2C=C1Cl)Br
Found 4 products.