CAS 1070879-41-2

4-Bromo-5-chloro-8-methylquinoline

Description:

4-Bromo-5-chloro-8-methylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 5 positions, respectively, along with a methyl group at the 8 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. The halogen substituents can influence the compound's reactivity and interaction with biological targets. Additionally, 4-Bromo-5-chloro-8-methylquinoline may be of interest in materials science and organic synthesis, where its reactivity can be harnessed for various chemical transformations. Safety data and handling precautions should be observed, as halogenated compounds can pose health risks.

Formula: C₁₀H₇BrClN

InChI: InChI=1S/C10H7BrClN/c1-6-2-3-8(12)9-7(11)4-5-13-10(6)9/h2-5H,1H3

InChI key: InChIKey=QLNSCSDZCRFWAD-UHFFFAOYSA-N

SMILES: CC=1C2=C(C(Cl)=CC1)C(Br)=CC=N2

Synonyms:

• 4-Bromo-5-chloro-8-methylquinoline
• Quinoline, 4-bromo-5-chloro-8-methyl-