CymitQuimica logo

CAS 1070879-55-8

:

4,8-Dibromo-2-methylquinoline

Description:
4,8-Dibromo-2-methylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of two bromine substituents at the 4 and 8 positions, along with a methyl group at the 2 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is likely to be insoluble or only slightly soluble in water, but may dissolve in organic solvents such as ethanol or dichloromethane. The bromine atoms enhance the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, the presence of the methyl group can influence the compound's electronic properties and steric hindrance. 4,8-Dibromo-2-methylquinoline may find applications in organic synthesis, materials science, and potentially in medicinal chemistry, although specific biological activities would require further investigation.
Formula:C10H7Br2N
InChI:InChI=1S/C10H7Br2N/c1-6-5-9(12)7-3-2-4-8(11)10(7)13-6/h2-5H,1H3
InChI key:InChIKey=ZTIXHNVOIKNFKE-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=C(C)C1)C(Br)=CC=C2
Synonyms:
  • 4,8-Dibromo-2-methylquinoline
  • Quinoline, 4,8-dibromo-2-methyl-
Found 3 products.