CymitQuimica logo

CAS 1070879-56-9

:

4-Bromo-2-methyl-6-(trifluoromethyl)quinoline

Description:
4-Bromo-2-methyl-6-(trifluoromethyl)quinoline is a synthetic organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a bromine atom at the 4-position, a methyl group at the 2-position, and a trifluoromethyl group at the 6-position of the quinoline ring. The presence of the bromine and trifluoromethyl groups significantly influences its chemical reactivity and physical properties, such as solubility and polarity. Typically, compounds like this exhibit biological activity, making them of interest in medicinal chemistry and drug development. The trifluoromethyl group, in particular, is known to enhance lipophilicity and metabolic stability. Additionally, the compound may exhibit fluorescence properties, which can be useful in various analytical applications. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C11H7BrF3N
InChI:InChI=1S/C11H7BrF3N/c1-6-4-9(12)8-5-7(11(13,14)15)2-3-10(8)16-6/h2-5H,1H3
InChI key:InChIKey=YWPPVOULZSSLBC-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=C(C)C1)C=CC(C(F)(F)F)=C2
Synonyms:
  • 4-Bromo-2-methyl-6-(trifluoromethyl)quinoline
  • Quinoline, 4-bromo-2-methyl-6-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.