CAS 1070879-59-2

4-Bromo-2,5,7-trimethylquinoline

Description:

4-Bromo-2,5,7-trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a bromine substituent at the 4-position and three methyl groups at the 2, 5, and 7 positions of the quinoline ring. The presence of these substituents influences its chemical properties, including its reactivity and solubility. Typically, brominated quinolines exhibit interesting biological activities, making them of interest in medicinal chemistry and material science. The compound is likely to be a yellow to brown solid, with moderate solubility in organic solvents. Its molecular structure may confer specific electronic properties, which can affect its behavior in chemical reactions, such as electrophilic substitutions or nucleophilic attacks. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the methyl and bromine groups. Overall, 4-Bromo-2,5,7-trimethylquinoline is a compound of interest for further research in various chemical applications.

Formula: C₁₂H₁₂BrN

InChI: InChI=1S/C12H12BrN/c1-7-4-8(2)12-10(13)6-9(3)14-11(12)5-7/h4-6H,1-3H3

InChI key: InChIKey=CPEXXDIUHQMTLZ-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=C(C)C=C2C)N=C(C)C1

Synonyms:

• Quinoline, 4-bromo-2,5,7-trimethyl-
• 4-Bromo-2,5,7-trimethylquinoline