CAS 1070879-63-8

4-Bromo-5,8-dichloro-2-methylquinoline

Description:

4-Bromo-5,8-dichloro-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at specific positions on the quinoline ring contributes to its chemical reactivity and potential biological activity. This compound typically exhibits a pale yellow to brownish color and is likely to be sparingly soluble in water but soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-withdrawing effects of the halogen atoms. Additionally, compounds with similar structures have been studied for their potential applications in pharmaceuticals, agrochemicals, and materials science, often due to their antimicrobial and anticancer properties. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₀H₆BrCl₂N

InChI: InChI=1S/C10H6BrCl2N/c1-5-4-6(11)9-7(12)2-3-8(13)10(9)14-5/h2-4H,1H3

InChI key: InChIKey=XCQJHNIDKYRMBU-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C(Br)=CC(C)=N2)C(Cl)=CC1

Synonyms:

• 4-Bromo-5,8-dichloro-2-methylquinoline
• Quinoline, 4-bromo-5,8-dichloro-2-methyl-