CAS 1070879-65-0

4-Bromo-6,8-dichloro-2-methylquinoline

Description:

4-Bromo-6,8-dichloro-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features three halogen substituents: a bromine atom at the 4-position and chlorine atoms at the 6 and 8 positions, along with a methyl group at the 2-position. These substitutions can significantly influence its chemical reactivity, solubility, and biological activity. The presence of halogens often enhances the compound's lipophilicity, potentially affecting its interactions with biological systems. 4-Bromo-6,8-dichloro-2-methylquinoline may exhibit antimicrobial or anticancer properties, common among halogenated quinolines, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents, which may also play a role in its synthesis and functionalization in various chemical reactions.

Formula: C₁₀H₆BrCl₂N

InChI: InChI=1S/C10H6BrCl2N/c1-5-2-8(11)7-3-6(12)4-9(13)10(7)14-5/h2-4H,1H3

InChI key: InChIKey=QRFLDZYRQUCSOJ-UHFFFAOYSA-N

SMILES: BrC=1C2=C(N=C(C)C1)C(Cl)=CC(Cl)=C2

Synonyms:

• 4-Bromo-6,8-dichloro-2-methylquinoline
• Quinoline, 4-bromo-6,8-dichloro-2-methyl-