
CAS 1070879-66-1
:4-Bromo-7,8-dichloro-2-methylquinoline
Description:
4-Bromo-7,8-dichloro-2-methylquinoline is a synthetic organic compound belonging to the quinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. This compound features a bromine atom at the 4-position and two chlorine atoms at the 7 and 8 positions, along with a methyl group at the 2-position, contributing to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of halogen substituents can influence its chemical behavior, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which could be of interest for medicinal chemistry research. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-7,8-dichloro-2-methylquinoline is a notable compound for its structural features and potential applications in chemical synthesis and biological studies.
Formula:C10H6BrCl2N
InChI:InChI=1S/C10H6BrCl2N/c1-5-4-7(11)6-2-3-8(12)9(13)10(6)14-5/h2-4H,1H3
InChI key:InChIKey=QDHVQUUNDXXKDB-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(Cl)=C(Cl)C=C2)N=C(C)C1
Synonyms:- Quinoline, 4-bromo-7,8-dichloro-2-methyl-
- 4-Bromo-7,8-dichloro-2-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.