CAS 1070879-67-2

4-Bromo-5-chloro-2,8-dimethylquinoline

Description:

4-Bromo-5-chloro-2,8-dimethylquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 5 positions, respectively, along with methyl groups at the 2 and 8 positions, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to the reactivity of the halogen substituents. The presence of multiple functional groups can also influence its electronic properties, making it a candidate for studies in medicinal chemistry or materials science. Additionally, the compound's stability and reactivity can be affected by environmental factors, which is important for its handling and storage in laboratory settings.

Formula: C₁₁H₉BrClN

InChI: InChI=1S/C11H9BrClN/c1-6-3-4-9(13)10-8(12)5-7(2)14-11(6)10/h3-5H,1-2H3

InChI key: InChIKey=KUIPKXPAYBWKRD-UHFFFAOYSA-N

SMILES: CC=1C2=C(C(Br)=CC(C)=N2)C(Cl)=CC1

Synonyms:

• 4-Bromo-5-chloro-2,8-dimethylquinoline
• Quinoline, 4-bromo-5-chloro-2,8-dimethyl-