CymitQuimica logo

CAS 1070879-68-3

:

4-Bromo-6-chloro-2,8-dimethylquinoline

Description:
4-Bromo-6-chloro-2,8-dimethylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 6 positions, respectively, along with methyl groups at the 2 and 8 positions, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent's polarity. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. Additionally, the halogen substituents can influence the compound's reactivity and interaction with biological targets. As with many halogenated compounds, it is essential to handle this substance with care, considering potential environmental and health impacts. Overall, 4-Bromo-6-chloro-2,8-dimethylquinoline represents a valuable compound for further research in various chemical and biological fields.
Formula:C11H9BrClN
InChI:InChI=1S/C11H9BrClN/c1-6-3-8(13)5-9-10(12)4-7(2)14-11(6)9/h3-5H,1-2H3
InChI key:InChIKey=IRIMGAFVUOMEJM-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=C(C)C1)C(C)=CC(Cl)=C2
Synonyms:
  • 4-Bromo-6-chloro-2,8-dimethylquinoline
  • Quinoline, 4-bromo-6-chloro-2,8-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.