CymitQuimica logo

CAS 1070879-69-4

:

4-Bromo-7-chloro-2,8-dimethylquinoline

Description:
4-Bromo-7-chloro-2,8-dimethylquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 7 positions, respectively, along with methyl groups at the 2 and 8 positions, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. Additionally, the halogen substituents can influence the compound's electronic properties and reactivity, making it a candidate for further chemical modifications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 4-Bromo-7-chloro-2,8-dimethylquinoline is of interest in various fields, including organic synthesis and drug discovery.
Formula:C11H9BrClN
InChI:InChI=1S/C11H9BrClN/c1-6-5-9(12)8-3-4-10(13)7(2)11(8)14-6/h3-5H,1-2H3
InChI key:InChIKey=ITXAGISRCZQTMO-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(C)=C(Cl)C=C2)N=C(C)C1
Synonyms:
  • Quinoline, 4-bromo-7-chloro-2,8-dimethyl-
  • 4-Bromo-7-chloro-2,8-dimethylquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.