
CAS 1070879-70-7
:4-Bromo-8-chloro-2,6-dimethylquinoline
Description:
4-Bromo-8-chloro-2,6-dimethylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 8 positions, respectively, along with methyl groups at the 2 and 6 positions, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The halogen substituents can influence the compound's reactivity, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the presence of multiple functional groups may impart interesting biological activities, warranting further investigation in medicinal chemistry. As with many quinoline derivatives, it may also exhibit fluorescence properties, which can be useful in analytical applications. Safety and handling precautions should be observed due to the potential toxicity of halogenated compounds.
Formula:C11H9BrClN
InChI:InChI=1S/C11H9BrClN/c1-6-3-8-9(12)5-7(2)14-11(8)10(13)4-6/h3-5H,1-2H3
InChI key:InChIKey=BSNZKNDQORFNPX-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=C(C)C1)C(Cl)=CC(C)=C2
Synonyms:- Quinoline, 4-bromo-8-chloro-2,6-dimethyl-
- 4-Bromo-8-chloro-2,6-dimethylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.