CAS 1070879-91-2

8-Methoxy-2-propyl-4-quinolinol

Description:

8-Methoxy-2-propyl-4-quinolinol, identified by its CAS number 1070879-91-2, is a chemical compound that belongs to the quinoline family, characterized by a bicyclic structure containing a nitrogen atom. This compound features a methoxy group (-OCH3) and a propyl group (-C3H7) attached to the quinoline ring, which can influence its solubility and biological activity. Typically, quinolinol derivatives are known for their potential pharmacological properties, including antimicrobial and antimalarial activities. The presence of the methoxy and propyl substituents may enhance its lipophilicity, affecting its interaction with biological membranes and its overall bioavailability. Additionally, the compound may exhibit chelating properties due to the quinoline moiety, which can bind metal ions, potentially leading to applications in medicinal chemistry or materials science. As with many organic compounds, its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species.

Formula: C₁₃H₁₅NO₂

InChI: InChI=1S/C13H15NO2/c1-3-5-9-8-11(15)10-6-4-7-12(16-2)13(10)14-9/h4,6-8H,3,5H2,1-2H3,(H,14,15)

InChI key: InChIKey=RSRRAIVWAVNHSP-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C(O)=CC(CCC)=N2)C=CC1

Synonyms:

• 8-Methoxy-2-propyl-4-quinolinol
• 4-Quinolinol, 8-methoxy-2-propyl-