CymitQuimica logo

CAS 1070879-94-5

:

7-Fluoro-2-propyl-4-quinolinol

Description:
7-Fluoro-2-propyl-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a fluorine atom at the 7-position and a propyl group at the 2-position contributes to its unique properties and potential biological activity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group at the 4-position, influencing its solubility and reactivity. Additionally, the fluorine substituent can enhance lipophilicity and metabolic stability, which are important factors in drug design. The compound's specific interactions with biological targets would depend on its conformation and the electronic effects imparted by the substituents. Overall, 7-Fluoro-2-propyl-4-quinolinol represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C12H12FNO
InChI:InChI=1S/C12H12FNO/c1-2-3-9-7-12(15)10-5-4-8(13)6-11(10)14-9/h4-7H,2-3H2,1H3,(H,14,15)
InChI key:InChIKey=RKZVEMLFZPWBSU-UHFFFAOYSA-N
SMILES:OC=1C2=C(N=C(CCC)C1)C=C(F)C=C2
Synonyms:
  • 7-Fluoro-2-propyl-4-quinolinol
  • 4-Quinolinol, 7-fluoro-2-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.