CymitQuimica logo

CAS 107095-01-2

:

N-methyl-4-nitro-1,3-dihydro-2,1,3-benzoselenadiazol-5-amine

Description:
N-methyl-4-nitro-1,3-dihydro-2,1,3-benzoselenadiazol-5-amine is a chemical compound characterized by its unique structure, which includes a benzene ring fused with a selenadiazole moiety. This compound features a nitro group and an amine group, contributing to its potential reactivity and biological activity. The presence of the methyl group at the nitrogen position enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The selenadiazole ring is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to participate in various chemical reactions. Additionally, the nitro group can serve as a precursor for further chemical modifications. Overall, N-methyl-4-nitro-1,3-dihydro-2,1,3-benzoselenadiazol-5-amine exhibits characteristics that may be valuable in research and development within organic and medicinal chemistry fields.
Formula:C7H8N4O2Se
InChI:InChI=1/C7H8N4O2Se/c1-8-5-3-2-4-6(10-14-9-4)7(5)11(12)13/h2-3,8-10H,1H3
SMILES:CNc1ccc2c(c1N(=O)=O)[nH][se][nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.