
CAS 107099-99-0
:2,5-Dimethoxybenzeneboronic acid
Description:
2,5-Dimethoxybenzeneboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a dimethoxy-substituted benzene ring. Its molecular structure features two methoxy groups (-OCH3) located at the 2 and 5 positions of the benzene ring, which influence its reactivity and solubility. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It is known for its utility in organic synthesis, particularly in Suzuki coupling reactions, where it acts as a boron source for the formation of carbon-carbon bonds. The presence of the boronic acid group allows for reversible interactions with diols, making it useful in various applications, including sensor technology and drug delivery systems. Additionally, 2,5-Dimethoxybenzeneboronic acid may exhibit interesting electronic properties due to the electron-donating nature of the methoxy groups, which can affect its reactivity and interactions with other chemical species.
Formula:C8H11BO4
InChI:InChI=1/C8H11BO4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5,10-11H,1-2H3
SMILES:COc1ccc(c(c1)B(O)O)OC
Synonyms:- 2,5-Dimethoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,5-Dimethoxybenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H11BO4Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powder or lumpsMolecular weight:181.98(2,5-Dimethoxyphenyl)boronic acid
CAS:Formula:C8H11BO4Purity:97%Color and Shape:SolidMolecular weight:181.98152,5-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO4Purity:97.0 to 110.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:181.982,5-Dimethoxybenzeneboronic acid
CAS:2,5-Dimethoxybenzeneboronic acid
Purity:98%Color and Shape:SolidMolecular weight:181.98g/mol2,5-Dimethoxybenzeneboronic acid
CAS:Formula:C8H11BO4Purity:97%Color and Shape:SolidMolecular weight:181.98






