
CAS 1070990-24-7
:2,6-Dimethylbenzenepropanal
Description:
2,6-Dimethylbenzenepropanal, also known as a substituted aromatic aldehyde, features a benzene ring with two methyl groups located at the 2 and 6 positions, along with a propanal side chain. This compound is characterized by its aromatic nature, which contributes to its stability and unique reactivity. The presence of the aldehyde functional group (-CHO) makes it a polar molecule, allowing for potential interactions such as hydrogen bonding. Typically, such compounds exhibit moderate volatility and may have distinctive odors, often associated with their aromatic structure. The methyl substituents can influence the compound's physical properties, such as boiling point and solubility, making it less soluble in water but more soluble in organic solvents. Additionally, 2,6-Dimethylbenzenepropanal may be utilized in various applications, including fragrance formulations and as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as aldehydes can be reactive and may pose health risks upon exposure.
Formula:C11H14O
InChI:InChI=1S/C11H14O/c1-9-5-3-6-10(2)11(9)7-4-8-12/h3,5-6,8H,4,7H2,1-2H3
InChI key:InChIKey=FNYPDOIEZBGABA-UHFFFAOYSA-N
SMILES:C(CC=O)C1=C(C)C=CC=C1C
Synonyms:- 2,6-Dimethylbenzenepropanal
- Benzenepropanal, 2,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.