
CAS 1071-18-7
:Ammonium butyl phosphorodithioate
Description:
Ammonium butyl phosphorodithioate, with the CAS number 1071-18-7, is an organophosphorus compound characterized by its phosphorodithioate functional group. This substance typically appears as a colorless to pale yellow liquid or solid, depending on its formulation and purity. It is soluble in water and various organic solvents, which enhances its utility in agricultural and industrial applications. The compound is primarily used as a pesticide and herbicide, functioning as a plant growth regulator and a means of pest control. Its mode of action involves inhibiting certain enzymes in pests, thereby disrupting their metabolic processes. Ammonium butyl phosphorodithioate is known for its relatively low toxicity to mammals, but it can be harmful to aquatic organisms, necessitating careful handling and application. Additionally, it may undergo hydrolysis in the presence of moisture, leading to the formation of other phosphorous-containing compounds. As with many organophosphates, safety precautions are essential during its use to mitigate potential environmental and health risks.
Formula:C8H19O2PS2·H3N
InChI:InChI=1S/C8H19O2PS2.H3N/c1-3-5-7-9-11(12,13)10-8-6-4-2;/h3-8H2,1-2H3,(H,12,13);1H3
InChI key:InChIKey=BIZBIDALHUESMY-UHFFFAOYSA-N
SMILES:O(P(OCCCC)(=S)S)CCCC.N
Synonyms:- Ammonium butyl phosphorodithioate
- Ammonium O,O-dibutyl dithiophosphate
- Dingjian Heiyao
- Phosphorodithioic acid, O,O-dibutyl ester, ammonium salt
- Phosphorodithioic acid, O,O-dibutyl ester, ammonium salt (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
O,O-Dibutyl Phosphorodithioate Ammonium Salt
CAS:Controlled ProductApplications O,O-Dibutyl Phosphorodithioate is an intermediate used to prepare oligodeoxyribonucleoside phosphorodithioates.
References Okruszek, A., et al.: J. Org. Chem., 60, 6998 (1995)Formula:C8H22NO2PS2Color and Shape:NeatMolecular weight:259.37O,o-Dibutyl phosphorodithioate ammonium salt
CAS:Please enquire for more information about O,o-Dibutyl phosphorodithioate ammonium salt including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H22NO2PS2Purity:Min. 95%Molecular weight:259.4 g/mol


