CAS 1071-94-9
:5-Hepten-2-one, (5E)-
Description:
5-Hepten-2-one, also known as (5E)-5-hepten-2-one, is an organic compound characterized by its unsaturated ketone structure. It features a seven-carbon chain with a double bond located between the fifth and sixth carbon atoms, and a ketone functional group at the second carbon. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as fruity or floral. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic nature. 5-Hepten-2-one is used in various applications, including as a flavoring agent and in the synthesis of other organic compounds. Its reactivity is influenced by the presence of both the double bond and the carbonyl group, making it susceptible to addition reactions. Additionally, it can participate in various chemical reactions, such as oxidation and reduction, which are important in organic synthesis and industrial processes. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H12O
InChI:InChI=1S/C7H12O/c1-3-4-5-6-7(2)8/h3-4H,5-6H2,1-2H3/b4-3+
InChI key:InChIKey=RTYRONIMTRDBLT-ONEGZZNKSA-N
SMILES:C(C/C=C/C)C(C)=O
Synonyms:- trans-5-Hepten-2-one
- 5-Hepten-2-one, (5E)-
- 5-Hepten-2-one, (E)-
- (5E)-5-Hepten-2-one
- (E)-5-Hepten-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.