CAS 1071223-07-8

2-Chloro-3-[cis-4-(4-chlorophenyl)cyclohexyl]-1,4-naphthalenedione

Description:

2-Chloro-3-[cis-4-(4-chlorophenyl)cyclohexyl]-1,4-naphthalenedione is a synthetic organic compound characterized by its complex structure, which includes a naphthalenedione core substituted with a chloro group and a cyclohexyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the chloro substituents can influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the cyclohexyl group can impart steric effects that may affect the compound's solubility and interaction with biological systems. Its unique structure suggests potential applications in pharmaceuticals or materials science, particularly in the development of compounds with specific biological activities or as intermediates in organic synthesis. However, detailed studies on its physical properties, such as melting point, boiling point, and solubility, would be necessary to fully characterize its behavior in different environments.

Formula: C₂₂H₁₈Cl₂O₂

InChI: InChI=1/C22H18Cl2O2/c23-16-11-9-14(10-12-16)13-5-7-15(8-6-13)19-20(24)22(26)18-4-2-1-3-17(18)21(19)25/h1-4,9-13,15H,5-8H2/t13-,15+

InChI key: InChIKey=QUUMPHYEOKHOOW-OTVXOJSONA-N

SMILES: O=C1C(=C(Cl)C(=O)C=2C1=CC=CC2)[C@@H]3CC[C@@H](CC3)C4=CC=C(Cl)C=C4

Synonyms:

• 2-Chloro-3-[cis-4-(4-chlorophenyl)cyclohexyl]-1,4-naphthalenedione
• 1,4-Naphthalenedione, 2-chloro-3-[cis-4-(4-chlorophenyl)cyclohexyl]-

Atovaquone Impurity 11

CAS: 1071223-07-8

Formula: C₂₂H₁₈Cl₂O₂

Molecular weight: 385.28

Ref: ST-EA-CP-A33016