CAS 1071329-00-4

2-(Diethylamino)-4-methyl-5-thiazolecarboxylic acid

Description:

2-(Diethylamino)-4-methyl-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the diethylamino group enhances its solubility and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding, making it potentially useful in various chemical reactions and biological systems. Its thiazole structure is known for contributing to antimicrobial and anti-inflammatory activities, suggesting potential therapeutic applications. The compound's molecular structure allows for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, 2-(Diethylamino)-4-methyl-5-thiazolecarboxylic acid represents a class of compounds with significant interest in medicinal chemistry and drug development.

Formula: C₉H₁₄N₂O₂S

InChI: InChI=1S/C9H14N2O2S/c1-4-11(5-2)9-10-6(3)7(14-9)8(12)13/h4-5H2,1-3H3,(H,12,13)

InChI key: InChIKey=CIPKPNGMPXQRBG-UHFFFAOYSA-N

SMILES: N(CC)(CC)C=1SC(C(O)=O)=C(C)N1

Synonyms:

• 5-Thiazolecarboxylic acid, 2-(diethylamino)-4-methyl-
• 2-(Diethylamino)-4-methyl-5-thiazolecarboxylic acid