CAS 107136-95-8
:Dipyridamole Di-O-b-D-glucuronide
Description:
Dipyridamole Di-O-b-D-glucuronide is a chemical compound that serves as a metabolite of dipyridamole, a drug primarily used as an antiplatelet agent and for the treatment of certain cardiovascular conditions. This compound is characterized by its glucuronidation, a process where glucuronic acid is conjugated to dipyridamole, enhancing its solubility and facilitating excretion. The structure features two glucuronic acid moieties attached to the dipyridamole backbone, which contributes to its pharmacokinetic properties. Dipyridamole Di-O-b-D-glucuronide is typically studied in the context of drug metabolism and pharmacology, as it may influence the therapeutic effects and safety profile of dipyridamole. Its solubility in aqueous solutions and stability under physiological conditions are important for understanding its behavior in biological systems. Additionally, the compound's interactions with various enzymes and transporters can provide insights into its role in drug-drug interactions and overall pharmacodynamics.
Formula:C36H56N8O16
InChI:InChI=1/C36H56N8O16/c45-15-11-43(13-17-57-33-25(51)21(47)23(49)27(59-33)31(53)54)35-38-20-19(29(39-35)41-7-3-1-4-8-41)37-36(40-30(20)42-9-5-2-6-10-42)44(12-16-46)14-18-58-34-26(52)22(48)24(50)28(60-34)32(55)56/h21-28,33-34,45-52H,1-18H2,(H,53,54)(H,55,56)/t21-,22+,23-,24+,25-,26+,27?,28?,33+,34-
Synonyms:- 2,2’,2’’,2’’’-[(4,8-Dipiperidinopyrimido[5,4-d]pyrimidine-2,6-diyl)dinitrilo]tetra-ethanol Di--D-glucuronide
- Dipyridamole Di-O--D-glucuronide
- 2,22,2[(4,8-Dipiperidinopyrimido[5,4-d]pyrimidine-2,6-diyl)dinitrilo]tetra-ethanol Di-b-D-glucuronide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Dipyridamole di-O-b-D-glucuronide
CAS:Dipyridamole di-O-b-D-glucuronide is a fluorinated oligosaccharide that has been synthesized using the click chemistry reaction. It is a monosaccharide that has been glycosylated and modified with methyl groups to produce a high purity product. The carbohydrate consists of one or more sugar units linked by glycosidic bonds. Carbohydrates are classified by their number of sugar units and by the presence of other chemical groups such as phosphate, sulfate, or hydroxyl. This product is also used in the synthesis of complex carbohydrates and polysaccharides.Formula:C36H56N8O16Purity:Min. 95%Molecular weight:856.87 g/mol


