CAS 1071382-80-3

6,7-Dihydro-9-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic acid hydrazide

Description:

6,7-Dihydro-9-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a quinolizine core fused with a carboxylic acid and hydrazide functional groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydrazide moiety, which can participate in various chemical reactions, including condensation and hydrazone formation. The presence of the methyl group and the carboxylic acid enhances its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses.

Formula: C₁₄H₁₅N₃O₂

InChI: InChI=1S/C14H15N3O2/c1-8-5-9-3-2-4-17-7-11(14(19)16-15)13(18)10(6-8)12(9)17/h5-7H,2-4,15H2,1H3,(H,16,19)

InChI key: InChIKey=JZHXRGWIMUIEHQ-UHFFFAOYSA-N

SMILES: O=C1C=2C=3N(C=C1C(NN)=O)CCCC3C=C(C)C2

Synonyms:

• 1H,5H-Benzo[ij]quinolizine-2-carboxylic acid, 6,7-dihydro-9-methyl-1-oxo-, hydrazide
• 6,7-Dihydro-9-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic acid hydrazide