CAS 107140-30-7: (2E,10E,12E,16Z,18E)-6-hydroxy-9-(hydroxymethyl)-3,5,7,11,15,17-hexamethyl-19-(3-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-8-oxononadeca-2,10,12,16,18-pentaenoic acid
Description:The chemical substance with the name "(2E,10E,12E,16Z,18E)-6-hydroxy-9-(hydroxymethyl)-3,5,7,11,15,17-hexamethyl-19-(3-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-8-oxononadeca-2,10,12,16,18-pentaenoic acid" and CAS number "107140-30-7" is a complex organic compound characterized by multiple functional groups and a long carbon chain. It features several double bonds, indicated by the E and Z configurations, which suggest specific geometric isomerism. The presence of hydroxyl (-OH) groups contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. The compound also contains a ketone functional group, which can participate in various chemical reactions. Its structure suggests it may have applications in fields such as biochemistry or pharmaceuticals, particularly due to its potential interactions with biological systems. The intricate arrangement of methyl groups and the unique pyran moiety may also impart specific properties, such as stability or reactivity, making it of interest for further study in synthetic and medicinal chemistry.
Formula:C32H46O7
InChI:InChI=1/C32H46O7/c1-20(15-22(3)11-13-28-24(5)12-14-30(36)39-28)9-8-10-21(2)17-27(19-33)32(38)26(7)31(37)25(6)16-23(4)18-29(34)35/h8,10-15,17-18,20,24-28,31,33,37H,9,16,19H2,1-7H3,(H,34,35)/b10-8+,13-11+,21-17+,22-15-,23-18+
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Kazusamycin B REF: 7W-GA4859CAS: 107140-30-7 | - - - | To inquire | Mon 03 Mar 25 |
![]() | PD 124895 REF: TM-T24601CAS: 107140-30-7 | 98% | To inquire | Mon 03 Mar 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
PD 124895
Ref: TM-T24601
1mg | To inquire |