
CAS 1071435-66-9
:(βS)-β-Amino-6-(trifluoromethyl)-3-pyridineethanol
Description:
(βS)-β-Amino-6-(trifluoromethyl)-3-pyridineethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The β-amino group indicates that it possesses both an amine and an alcohol functional group, which can participate in hydrogen bonding, making it soluble in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural features, which could interact with various biological targets. Its stereochemistry, indicated by the (βS) designation, suggests specific spatial arrangements that can influence its reactivity and interactions in biological systems. Overall, (βS)-β-Amino-6-(trifluoromethyl)-3-pyridineethanol is a compound of interest in medicinal chemistry and drug development, particularly for its potential applications in therapeutic contexts.
Formula:C8H9F3N2O
InChI:InChI=1S/C8H9F3N2O/c9-8(10,11)7-2-1-5(3-13-7)6(12)4-14/h1-3,6,14H,4,12H2/t6-/m1/s1
InChI key:InChIKey=KBOMPSGVSUAHRA-ZCFIWIBFSA-N
SMILES:C(F)(F)(F)C1=CC=C([C@@H](CO)N)C=N1
Synonyms:- (2S)-2-Amino-2-[6-(trifluoromethyl)pyridin-3-yl]ethan-1-ol
- 3-Pyridineethanol, β-amino-6-(trifluoromethyl)-, (βS)-
- (βS)-β-Amino-6-(trifluoromethyl)-3-pyridineethanol
- (S)-2-Amino-2-[6-(trifluoromethyl)pyridin-3-yl]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-2-Amino-2-(6-(trifluoromethyl)pyridin-3-yl)ethanol
CAS:Formula:C8H9F3N2OMolecular weight:206.1651
