CAS 1071455-14-5

B-(3-Methyl-1H-pyrazol-4-yl)boronic acid

Description:

B-(3-Methyl-1H-pyrazol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the 3-methyl group on the pyrazole ring can influence its reactivity and solubility, as well as its interaction with biological targets. Additionally, boronic acids are known for their ability to form reversible covalent bonds with diols, which can be exploited in drug design and delivery systems. Overall, B-(3-Methyl-1H-pyrazol-4-yl)boronic acid is a versatile compound with applications in synthetic chemistry and potential therapeutic uses.

Formula: C₄H₇BN₂O₂

InChI: InChI=1S/C4H7BN2O2/c1-3-4(5(8)9)2-6-7-3/h2,8-9H,1H3,(H,6,7)

InChI key: InChIKey=ZYXMOCKFGABUGK-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C(C)=NNC1

Synonyms:

• (5-Methyl-1H-pyrazol-4-yl)boronic acid
• 3-Methyl-1H-pyrazol-4-ylboronic acid
• 3-Methyl-1H-pyrazole-4-boronic acid
• 3-Methylpyrazole-4-boronic acid
• B-(3-Methyl-1H-pyrazol-4-yl)boronic acid
• Boronic acid, B-(3-methyl-1H-pyrazol-4-yl)-

3-Methylpyrazole-4-boronic acid

CAS: 1071455-14-5

Formula: C₄H₇BN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.9216

Ref: IN-DA0038BN

(3-Methyl-1H-pyrazol-4-yl)boronic acid

CAS: 1071455-14-5

(3-Methyl-1H-pyrazol-4-yl)boronic acid

Purity: 97%

Molecular weight: 125.92g/mol

Ref: 54-OR74066

(5-methyl-1H-pyrazol-4-yl)boronic acid

CAS: 1071455-14-5

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.9199982

Ref: 10-F601592