CymitQuimica logo

CAS 107153-52-6

:

2,4-Dimethoxybenzenebutanol

Description:
2,4-Dimethoxybenzenebutanol, with the CAS number 107153-52-6, is an organic compound characterized by its aromatic structure and the presence of both methoxy groups and a butanol side chain. The compound features a benzene ring substituted at the 2 and 4 positions with methoxy (-OCH3) groups, which can influence its reactivity and solubility. The butanol moiety contributes to its hydrophilicity, making it more soluble in polar solvents compared to purely aromatic compounds. This compound may exhibit interesting biological activities due to the presence of the hydroxyl group, which can participate in hydrogen bonding. Its physical properties, such as melting point, boiling point, and density, would depend on the specific molecular interactions and the arrangement of its substituents. Additionally, 2,4-Dimethoxybenzenebutanol may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a precursor for more complex molecules.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c1-14-11-7-6-10(5-3-4-8-13)12(9-11)15-2/h6-7,9,13H,3-5,8H2,1-2H3
InChI key:InChIKey=NVWFUOVOPMFJSX-UHFFFAOYSA-N
SMILES:C(CCCO)C1=C(OC)C=C(OC)C=C1
Synonyms:
  • Benzenebutanol, 2,4-dimethoxy-
  • 1-Butanol, 4-(2,4-dimethoxyphenyl)-
  • 2,4-Dimethoxybenzenebutanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.