CAS 1071634-39-3

4,4′-Bipiperidine, 1-methyl-, hydrochloride (1:2)

Description:

4,4′-Bipiperidine, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its structure, which consists of two piperidine rings connected by a carbon chain, with a methyl group attached to one of the nitrogen atoms. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in organic synthesis and medicinal chemistry. It exhibits basic properties due to the presence of nitrogen atoms in the piperidine rings, allowing it to participate in protonation reactions. The compound may be utilized in the development of pharmaceuticals, particularly in the synthesis of compounds with potential therapeutic effects. Safety data indicates that, like many nitrogen-containing heterocycles, it should be handled with care, as it may pose health risks if ingested or inhaled. Its specific reactivity and interactions depend on the functional groups present and the conditions under which it is used.

Formula: C₁₁H₂₂N₂·2ClH

InChI: InChI=1S/C11H22N2.2ClH/c1-13-8-4-11(5-9-13)10-2-6-12-7-3-10;;/h10-12H,2-9H2,1H3;2*1H

InChI key: InChIKey=WBRHBLOALHYJLC-UHFFFAOYSA-N

SMILES: CN1CCC(CC1)C2CCNCC2.Cl

Synonyms:

• 4,4′-Bipiperidine, 1-methyl-, hydrochloride (1:2)
• 1-Methyl-[4,4′]bipiperidinyl dihydrochloride
• 1-Methyl-4,4′-bipiperidine dihydrochloride