CAS 107167-31-7

Lactivicin

Description:

Lactivicin, with the CAS number 107167-31-7, is a naturally occurring antibiotic produced by certain strains of the bacterium *Streptomyces*. It is characterized by its ability to inhibit the growth of various Gram-positive bacteria, making it of interest in the field of microbiology and pharmaceuticals. Lactivicin exhibits a unique structure that includes a complex polyketide backbone, which contributes to its biological activity. The compound is known for its potential applications in treating bacterial infections, particularly those resistant to conventional antibiotics. Additionally, Lactivicin has been studied for its effects on bacterial cell wall synthesis, which is a critical target for many antibiotics. Its mechanism of action involves interference with essential cellular processes, leading to bacterial cell death. As research continues, Lactivicin may offer insights into the development of new antimicrobial agents, especially in the context of rising antibiotic resistance. However, further studies are necessary to fully understand its pharmacological properties and potential therapeutic applications.

Formula: C₁₀H₁₂N₂O₇

InChI: InChI=1S/C10H12N2O7/c1-5(13)11-6-4-18-12(8(6)15)10(9(16)17)3-2-7(14)19-10/h6H,2-4H2,1H3,(H,11,13)(H,16,17)

InChI key: InChIKey=ZUEKKUYIXILDAF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(OC(=O)CC1)N2C(=O)C(NC(C)=O)CO2

Synonyms:

• Lactivicin
• 2-(4-Acetamido-3-oxoisoxazolidin-2-yl)-5-oxotetrahydrofuran-2-carboxylic acid
• 2-[4-(Acetylamino)-3-oxo-2-isoxazolidinyl]tetrahydro-5-oxo-2-furancarboxylic acid
• 2-Furancarboxylic acid, 2-[4-(acetylamino)-3-oxo-2-isoxazolidinyl]tetrahydro-5-oxo-

Lactivicin

CAS: 107167-31-7

Lactivicin is a non-beta-lactam antibiotic that acts by binding to penicillin-binding proteins.

Formula: C₁₀H₁₂N₂O₇

Color and Shape: Solid

Molecular weight: 272.21

Ref: TM-T25597