CymitQuimica logo

CAS 107171-75-5

:

(R)-(—)-2-Benzylamino-1-phenylethanol

Description:
(R)-(−)-2-Benzylamino-1-phenylethanol, with the CAS number 107171-75-5, is a chiral organic compound characterized by its amine and alcohol functional groups. It features a benzyl group and a phenyl group attached to a central carbon atom, which contributes to its stereochemistry and potential biological activity. The presence of the amino group suggests that it can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is often studied in the context of asymmetric synthesis and medicinal chemistry due to its potential as a chiral auxiliary or ligand. Its stereochemistry is crucial for its interaction with biological targets, making it of interest in pharmacology. Additionally, the compound's physical properties, such as melting point and solubility, can vary based on its specific stereoisomer and the conditions under which it is studied. Overall, (R)-(−)-2-Benzylamino-1-phenylethanol exemplifies the importance of chirality in organic compounds and their applications in various fields of chemistry and biochemistry.
Formula:C15H17NO
InChI:InChI=1/C15H17NO/c17-15(14-9-5-2-6-10-14)12-16-11-13-7-3-1-4-8-13/h1-10,15-17H,11-12H2/t15-/m0/s1
InChI key:XAOCLQUZOIZSHV-HNNXBMFYSA-N
SMILES:c1ccc(cc1)CNC[C@@H](c1ccccc1)O
Synonyms:
  • (1R)-2-(benzylamino)-1-phenylethanol
  • (R)-(-)-2-Benzylamino-1-Phenylethanol
Found 3 products.