CAS 1071847-27-2
:(3E)-ethyl-4-ethoxy-3-methyl-2-oxobut-3-enoate
Description:
(3E)-ethyl-4-ethoxy-3-methyl-2-oxobut-3-enoate is an organic compound characterized by its unique structure, which includes an enone functional group and an ester moiety. This compound features a double bond in the trans configuration (3E), indicating the specific geometric arrangement of substituents around the double bond. The presence of the ethoxy group contributes to its solubility in organic solvents and may influence its reactivity and interactions with other chemical species. The methyl group and the carbonyl group in the structure suggest potential sites for chemical reactivity, making it a candidate for various synthetic applications in organic chemistry. Additionally, the compound's molecular framework may exhibit interesting properties such as potential biological activity or utility in materials science, depending on its specific interactions and stability under different conditions. Overall, (3E)-ethyl-4-ethoxy-3-methyl-2-oxobut-3-enoate represents a versatile structure with implications in both synthetic and applied chemistry.
Formula:C9H14O4
InChI:InChI=1S/C9H14O4/c1-4-12-6-7(3)8(10)9(11)13-5-2/h6H,4-5H2,1-3H3/b7-6+
Synonyms:- (E)-Ethyl 4-ethoxy-3-Methyl-2-oxobut-3-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
