CAS 107188-68-1
:5-bromo-2,3-dimethoxy-N-((1-(4-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide
Description:
5-Bromo-2,3-dimethoxy-N-((1-(4-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide, with CAS number 107188-68-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a bromine atom, methoxy groups, and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the bromine atom may enhance lipophilicity, influencing its solubility and permeability in biological systems. The methoxy groups can affect the electronic properties of the aromatic ring, potentially modulating interactions with biological targets. Additionally, the pyrrolidine ring suggests possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry. The compound's structure indicates it may have applications in pharmacology, particularly in the development of therapeutics targeting central nervous system disorders. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination.
Formula:C21H24BrFN2O3
InChI:InChI=1/C21H24BrFN2O3/c1-27-19-11-15(22)10-18(20(19)28-2)21(26)24-12-17-4-3-9-25(17)13-14-5-7-16(23)8-6-14/h5-8,10-11,17H,3-4,9,12-13H2,1-2H3,(H,24,26)
SMILES:COc1cc(cc(c1OC)C(=NCC1CCCN1Cc1ccc(cc1)F)O)Br
Synonyms:- Ncq 115
- 5-Bromo-2,3-dimethoxy-N-((1-((2,5-3H)-4-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide
- Benzamide, 5-bromo-N-((1-((4-fluorophenyl)methyl)-2-pyrrolidinyl)methyl)-2,3-dimethoxy-
- 5-bromo-N-{[1-(4-fluorobenzyl)pyrrolidin-2-yl]methyl}-2,3-dimethoxybenzamide
- 5-Bromo-2,3-dimethoxy-N-((1-(4-fluorobenzyl)-2-pyrrolidinyl)methyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.