
CAS 1071973-96-0
:5-Methoxy-6-methyl-1H-indole-3-carbonitrile
Description:
5-Methoxy-6-methyl-1H-indole-3-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methoxy group at the 5-position and a methyl group at the 6-position contributes to its unique properties and reactivity. The carbonitrile functional group at the 3-position enhances its potential for various chemical reactions, including nucleophilic additions and cycloadditions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Overall, 5-Methoxy-6-methyl-1H-indole-3-carbonitrile represents a versatile scaffold for further chemical modifications and applications in research and industry.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-7-3-10-9(4-11(7)14-2)8(5-12)6-13-10/h3-4,6,13H,1-2H3
InChI key:InChIKey=KHIHRNCHRZMWNQ-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(=CC(C)=C(OC)C2)NC1
Synonyms:- 5-Methoxy-6-methyl-1H-indole-3-carbonitrile
- 1H-Indole-3-carbonitrile, 5-methoxy-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.