CAS 1072-05-5
:2,6-Dimethylheptane
Description:
2,6-Dimethylheptane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C9H20, indicating it consists of nine carbon atoms and twenty hydrogen atoms. This compound features two methyl groups attached to the second and sixth carbon atoms of a heptane backbone, contributing to its branched structure. 2,6-Dimethylheptane is a colorless liquid at room temperature and is known for its relatively low volatility and high boiling point compared to straight-chain alkanes of similar molecular weight. It is insoluble in water but soluble in organic solvents, making it useful in various industrial applications, including as a solvent and in fuel formulations. The compound exhibits typical alkane characteristics, such as being non-polar and having low reactivity under standard conditions. Its presence in gasoline contributes to the overall octane rating, which is essential for engine performance. Safety data indicates that it should be handled with care, as it can be flammable and may pose health risks upon prolonged exposure.
Formula:C9H20
InChI:InChI=1/C9H20/c1-8(2)6-5-7-9(3)4/h8-9H,5-7H2,1-4H3
SMILES:CC(C)CCCC(C)C
Synonyms:- Heptane, 2,6-dimethyl-
- 2,6-Dimethyl heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.